C13H8F3N3 — CID 62895867
3-[(2,3,4-trifluoroanilino)methyl]pyridine-2-carbonitrile (PubChem CID 62895867) has the molecular formula C13H8F3N3 and a molecular weight of 263.22 g/mol. Its IUPAC name is 3-[(2,3,4-trifluoroanilino)methyl]pyridine-2-carbonitrile.
| Compound Name | 3-[(2,3,4-trifluoroanilino)methyl]pyridine-2-carbonitrile |
|---|---|
| PubChem CID | 62895867 |
| Molecular Formula | C13H8F3N3 |
| Molecular Weight | 263.22 g/mol |
| Exact Mass | 263.07 |
| IUPAC Name | 3-[(2,3,4-trifluoroanilino)methyl]pyridine-2-carbonitrile |
| SMILES | N#Cc1ncccc1CNc1ccc(F)c(F)c1F |
| InChI | InChI=1S/C13H8F3N3/c14-9-3-4-10(13(16)12(9)15)19-7-8-2-1-5-18-11(8)6-17/h1-5,19H,7H2 |
| InChIKey | LQBZWRMRKNMRST-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 48.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.22 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|