C11H6F2N4O2S — CID 106598901
2-cyano-N-(2,6-difluoro-3-pyridinyl)pyridine-3-sulfonamide (PubChem CID 106598901) has the molecular formula C11H6F2N4O2S and a molecular weight of 296.26 g/mol. Its IUPAC name is 2-cyano-N-(2,6-difluoro-3-pyridinyl)pyridine-3-sulfonamide.
| Compound Name | 2-cyano-N-(2,6-difluoro-3-pyridinyl)pyridine-3-sulfonamide |
|---|---|
| PubChem CID | 106598901 |
| Molecular Formula | C11H6F2N4O2S |
| Molecular Weight | 296.26 g/mol |
| Exact Mass | 296.02 |
| IUPAC Name | 2-cyano-N-(2,6-difluoro-3-pyridinyl)pyridine-3-sulfonamide |
| SMILES | N#Cc1ncccc1S(=O)(=O)Nc1ccc(F)nc1F |
| InChI | InChI=1S/C11H6F2N4O2S/c12-10-4-3-7(11(13)16-10)17-20(18,19)9-2-1-5-15-8(9)6-14/h1-5,17H |
| InChIKey | YUIDCBCTDSJRJZ-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 95.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.26 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|