C14H13N3O2S — CID 106595467
2-cyano-N-(2,6-dimethylphenyl)pyridine-3-sulfonamide (PubChem CID 106595467) has the molecular formula C14H13N3O2S and a molecular weight of 287.34 g/mol. Its IUPAC name is 2-cyano-N-(2,6-dimethylphenyl)pyridine-3-sulfonamide.
| Compound Name | 2-cyano-N-(2,6-dimethylphenyl)pyridine-3-sulfonamide |
|---|---|
| PubChem CID | 106595467 |
| Molecular Formula | C14H13N3O2S |
| Molecular Weight | 287.34 g/mol |
| Exact Mass | 287.07 |
| IUPAC Name | 2-cyano-N-(2,6-dimethylphenyl)pyridine-3-sulfonamide |
| SMILES | Cc1cccc(C)c1NS(=O)(=O)c1cccnc1C#N |
| InChI | InChI=1S/C14H13N3O2S/c1-10-5-3-6-11(2)14(10)17-20(18,19)13-7-4-8-16-12(13)9-15/h3-8,17H,1-2H3 |
| InChIKey | BQTOGUYRLZQQFT-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 82.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.34 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |