C11H9N5O2S — CID 106598402
N-(6-amino-3-pyridinyl)-2-cyanopyridine-3-sulfonamide (PubChem CID 106598402) has the molecular formula C11H9N5O2S and a molecular weight of 275.29 g/mol. Its IUPAC name is N-(6-amino-3-pyridinyl)-2-cyanopyridine-3-sulfonamide.
| Compound Name | N-(6-amino-3-pyridinyl)-2-cyanopyridine-3-sulfonamide |
|---|---|
| PubChem CID | 106598402 |
| Molecular Formula | C11H9N5O2S |
| Molecular Weight | 275.29 g/mol |
| Exact Mass | 275.05 |
| IUPAC Name | N-(6-amino-3-pyridinyl)-2-cyanopyridine-3-sulfonamide |
| SMILES | N#Cc1ncccc1S(=O)(=O)Nc1ccc(N)nc1 |
| InChI | InChI=1S/C11H9N5O2S/c12-6-9-10(2-1-5-14-9)19(17,18)16-8-3-4-11(13)15-7-8/h1-5,7,16H,(H2,13,15) |
| InChIKey | PEILOABAIOOYEL-UHFFFAOYSA-N |
| XLogP | 0.73 |
| TPSA | 121.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.29 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |