C12H6Br3N3O2S — CID 106595571
2-cyano-N-(2,4,6-tribromophenyl)pyridine-3-sulfonamide (PubChem CID 106595571) has the molecular formula C12H6Br3N3O2S and a molecular weight of 495.98 g/mol. Its IUPAC name is 2-cyano-N-(2,4,6-tribromophenyl)pyridine-3-sulfonamide.
| Compound Name | 2-cyano-N-(2,4,6-tribromophenyl)pyridine-3-sulfonamide |
|---|---|
| PubChem CID | 106595571 |
| Molecular Formula | C12H6Br3N3O2S |
| Molecular Weight | 495.98 g/mol |
| Exact Mass | 492.77 |
| IUPAC Name | 2-cyano-N-(2,4,6-tribromophenyl)pyridine-3-sulfonamide |
| SMILES | N#Cc1ncccc1S(=O)(=O)Nc1c(Br)cc(Br)cc1Br |
| InChI | InChI=1S/C12H6Br3N3O2S/c13-7-4-8(14)12(9(15)5-7)18-21(19,20)11-2-1-3-17-10(11)6-16/h1-5,18H |
| InChIKey | OLZWCRHDUQBLJE-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 82.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.98 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |