C14H12BrN3O2S — CID 106595530
N-(4-bromo-2,6-dimethylphenyl)-2-cyanopyridine-3-sulfonamide (PubChem CID 106595530) has the molecular formula C14H12BrN3O2S and a molecular weight of 366.24 g/mol. Its IUPAC name is N-(4-bromo-2,6-dimethylphenyl)-2-cyanopyridine-3-sulfonamide.
| Compound Name | N-(4-bromo-2,6-dimethylphenyl)-2-cyanopyridine-3-sulfonamide |
|---|---|
| PubChem CID | 106595530 |
| Molecular Formula | C14H12BrN3O2S |
| Molecular Weight | 366.24 g/mol |
| Exact Mass | 364.98 |
| IUPAC Name | N-(4-bromo-2,6-dimethylphenyl)-2-cyanopyridine-3-sulfonamide |
| SMILES | Cc1cc(Br)cc(C)c1NS(=O)(=O)c1cccnc1C#N |
| InChI | InChI=1S/C14H12BrN3O2S/c1-9-6-11(15)7-10(2)14(9)18-21(19,20)13-4-3-5-17-12(13)8-16/h3-7,18H,1-2H3 |
| InChIKey | ATTJAHSFPNMHEE-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 82.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.24 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |