C13H6ClF6NO2S — CID 26969725
2-chloro-5-(trifluoromethyl)-N-(2,3,4-trifluorophenyl)benzenesulfonamide (PubChem CID 26969725) has the molecular formula C13H6ClF6NO2S and a molecular weight of 389.70 g/mol. Its IUPAC name is 2-chloro-5-(trifluoromethyl)-N-(2,3,4-trifluorophenyl)benzenesulfonamide.
| Compound Name | 2-chloro-5-(trifluoromethyl)-N-(2,3,4-trifluorophenyl)benzenesulfonamide |
|---|---|
| PubChem CID | 26969725 |
| Molecular Formula | C13H6ClF6NO2S |
| Molecular Weight | 389.70 g/mol |
| Exact Mass | 388.97 |
| IUPAC Name | 2-chloro-5-(trifluoromethyl)-N-(2,3,4-trifluorophenyl)benzenesulfonamide |
| SMILES | O=S(=O)(Nc1ccc(F)c(F)c1F)c1cc(C(F)(F)F)ccc1Cl |
| InChI | InChI=1S/C13H6ClF6NO2S/c14-7-2-1-6(13(18,19)20)5-10(7)24(22,23)21-9-4-3-8(15)11(16)12(9)17/h1-5,21H |
| InChIKey | FUEMAHPPAACTRN-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.70 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|