C17H14ClN3O5S — CID 59353036
methyl 2-[4-[(3-chloroquinoxalin-2-yl)sulfamoyl]phenoxy]acetate (PubChem CID 59353036) has the molecular formula C17H14ClN3O5S and a molecular weight of 407.84 g/mol. Its IUPAC name is methyl 2-[4-[(3-chloroquinoxalin-2-yl)sulfamoyl]phenoxy]acetate.
| Compound Name | methyl 2-[4-[(3-chloroquinoxalin-2-yl)sulfamoyl]phenoxy]acetate |
|---|---|
| PubChem CID | 59353036 |
| Molecular Formula | C17H14ClN3O5S |
| Molecular Weight | 407.84 g/mol |
| Exact Mass | 407.03 |
| IUPAC Name | methyl 2-[4-[(3-chloroquinoxalin-2-yl)sulfamoyl]phenoxy]acetate |
| SMILES | COC(=O)COc1ccc(S(=O)(=O)Nc2nc3ccccc3nc2Cl)cc1 |
| InChI | InChI=1S/C17H14ClN3O5S/c1-25-15(22)10-26-11-6-8-12(9-7-11)27(23,24)21-17-16(18)19-13-4-2-3-5-14(13)20-17/h2-9H,10H2,1H3,(H,20,21) |
| InChIKey | HXCDVXCICUZSKA-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 107.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.84 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |