C19H15Cl2NO6S2 — CID 169372336
2-chloro-5-(4-chlorophenoxy)-4-[(4-methylphenyl)sulfonylamino]benzenesulfonic acid (PubChem CID 169372336) has the molecular formula C19H15Cl2NO6S2 and a molecular weight of 488.37 g/mol. Its IUPAC name is 2-chloro-5-(4-chlorophenoxy)-4-[(4-methylphenyl)sulfonylamino]benzenesulfonic acid.
| Compound Name | 2-chloro-5-(4-chlorophenoxy)-4-[(4-methylphenyl)sulfonylamino]benzenesulfonic acid |
|---|---|
| PubChem CID | 169372336 |
| Molecular Formula | C19H15Cl2NO6S2 |
| Molecular Weight | 488.37 g/mol |
| Exact Mass | 486.97 |
| IUPAC Name | 2-chloro-5-(4-chlorophenoxy)-4-[(4-methylphenyl)sulfonylamino]benzenesulfonic acid |
| SMILES | Cc1ccc(S(=O)(=O)Nc2cc(Cl)c(S(=O)(=O)O)cc2Oc2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C19H15Cl2NO6S2/c1-12-2-8-15(9-3-12)29(23,24)22-17-10-16(21)19(30(25,26)27)11-18(17)28-14-6-4-13(20)5-7-14/h2-11,22H,1H3,(H,25,26,27) |
| InChIKey | QQZITRNMAKPMAF-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 109.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.37 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|