C16H9Cl2N3O4S — CID 168544216
2-chloro-5-(4-chlorophenoxy)-4-(2,2-dicyanoethenylamino)benzenesulfonic acid (PubChem CID 168544216) has the molecular formula C16H9Cl2N3O4S and a molecular weight of 410.24 g/mol. Its IUPAC name is 2-chloro-5-(4-chlorophenoxy)-4-(2,2-dicyanoethenylamino)benzenesulfonic acid.
| Compound Name | 2-chloro-5-(4-chlorophenoxy)-4-(2,2-dicyanoethenylamino)benzenesulfonic acid |
|---|---|
| PubChem CID | 168544216 |
| Molecular Formula | C16H9Cl2N3O4S |
| Molecular Weight | 410.24 g/mol |
| Exact Mass | 408.97 |
| IUPAC Name | 2-chloro-5-(4-chlorophenoxy)-4-(2,2-dicyanoethenylamino)benzenesulfonic acid |
| SMILES | N#CC(C#N)=CNc1cc(Cl)c(S(=O)(=O)O)cc1Oc1ccc(Cl)cc1 |
| InChI | InChI=1S/C16H9Cl2N3O4S/c17-11-1-3-12(4-2-11)25-15-6-16(26(22,23)24)13(18)5-14(15)21-9-10(7-19)8-20/h1-6,9,21H,(H,22,23,24) |
| InChIKey | ZYNCIZYXYVHDTP-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 123.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.24 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|