C12H9ClN4O — CID 168542038
5-chloro-2-(2,2-dicyanoethenylamino)-N-methylbenzamide (PubChem CID 168542038) has the molecular formula C12H9ClN4O and a molecular weight of 260.68 g/mol. Its IUPAC name is 5-chloro-2-(2,2-dicyanoethenylamino)-N-methylbenzamide.
| Compound Name | 5-chloro-2-(2,2-dicyanoethenylamino)-N-methylbenzamide |
|---|---|
| PubChem CID | 168542038 |
| Molecular Formula | C12H9ClN4O |
| Molecular Weight | 260.68 g/mol |
| Exact Mass | 260.05 |
| IUPAC Name | 5-chloro-2-(2,2-dicyanoethenylamino)-N-methylbenzamide |
| SMILES | CNC(=O)c1cc(Cl)ccc1NC=C(C#N)C#N |
| InChI | InChI=1S/C12H9ClN4O/c1-16-12(18)10-4-9(13)2-3-11(10)17-7-8(5-14)6-15/h2-4,7,17H,1H3,(H,16,18) |
| InChIKey | UNBMMICDDUQQBG-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 88.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.68 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|