C15H15Cl2N3O3 — CID 70627822
propan-2-yl 2-cyano-3-[2,5-dichloro-3-(methylcarbamoyl)anilino]prop-2-enoate (PubChem CID 70627822) has the molecular formula C15H15Cl2N3O3 and a molecular weight of 356.21 g/mol. Its IUPAC name is propan-2-yl 2-cyano-3-[2,5-dichloro-3-(methylcarbamoyl)anilino]prop-2-enoate.
| Compound Name | propan-2-yl 2-cyano-3-[2,5-dichloro-3-(methylcarbamoyl)anilino]prop-2-enoate |
|---|---|
| PubChem CID | 70627822 |
| Molecular Formula | C15H15Cl2N3O3 |
| Molecular Weight | 356.21 g/mol |
| Exact Mass | 355.05 |
| IUPAC Name | propan-2-yl 2-cyano-3-[2,5-dichloro-3-(methylcarbamoyl)anilino]prop-2-enoate |
| SMILES | CNC(=O)c1cc(Cl)cc(NC=C(C#N)C(=O)OC(C)C)c1Cl |
| InChI | InChI=1S/C15H15Cl2N3O3/c1-8(2)23-15(22)9(6-18)7-20-12-5-10(16)4-11(13(12)17)14(21)19-3/h4-5,7-8,20H,1-3H3,(H,19,21) |
| InChIKey | ZWWXQODFQWNPRQ-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 91.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.21 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|