C14H11Cl3N2O4 — CID 88811954
2,3,6-trichloro-5-[(2-cyano-3-oxo-3-propan-2-yloxyprop-1-enyl)amino]benzoic acid (PubChem CID 88811954) has the molecular formula C14H11Cl3N2O4 and a molecular weight of 377.61 g/mol. Its IUPAC name is 2,3,6-trichloro-5-[(2-cyano-3-oxo-3-propan-2-yloxyprop-1-enyl)amino]benzoic acid.
| Compound Name | 2,3,6-trichloro-5-[(2-cyano-3-oxo-3-propan-2-yloxyprop-1-enyl)amino]benzoic acid |
|---|---|
| PubChem CID | 88811954 |
| Molecular Formula | C14H11Cl3N2O4 |
| Molecular Weight | 377.61 g/mol |
| Exact Mass | 375.98 |
| IUPAC Name | 2,3,6-trichloro-5-[(2-cyano-3-oxo-3-propan-2-yloxyprop-1-enyl)amino]benzoic acid |
| SMILES | CC(C)OC(=O)C(C#N)=CNc1cc(Cl)c(Cl)c(C(=O)O)c1Cl |
| InChI | InChI=1S/C14H11Cl3N2O4/c1-6(2)23-14(22)7(4-18)5-19-9-3-8(15)11(16)10(12(9)17)13(20)21/h3,5-6,19H,1-2H3,(H,20,21) |
| InChIKey | VQOFBIBWAFDRHR-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 99.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.61 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|