C13H13Cl2N3O — CID 108829487
(Z)-2-cyano-3-(2,5-dichloroanilino)-N-propan-2-ylprop-2-enamide (PubChem CID 108829487) has the molecular formula C13H13Cl2N3O and a molecular weight of 298.17 g/mol. Its IUPAC name is (Z)-2-cyano-3-(2,5-dichloroanilino)-N-propan-2-ylprop-2-enamide.
| Compound Name | (Z)-2-cyano-3-(2,5-dichloroanilino)-N-propan-2-ylprop-2-enamide |
|---|---|
| PubChem CID | 108829487 |
| Molecular Formula | C13H13Cl2N3O |
| Molecular Weight | 298.17 g/mol |
| Exact Mass | 297.04 |
| IUPAC Name | (Z)-2-cyano-3-(2,5-dichloroanilino)-N-propan-2-ylprop-2-enamide |
| SMILES | CC(C)NC(=O)/C(C#N)=C\Nc1cc(Cl)ccc1Cl |
| InChI | InChI=1S/C13H13Cl2N3O/c1-8(2)18-13(19)9(6-16)7-17-12-5-10(14)3-4-11(12)15/h3-5,7-8,17H,1-2H3,(H,18,19)/b9-7- |
| InChIKey | NXEHZJJVILUXFM-CLFYSBASSA-N |
| XLogP | 3.34 |
| TPSA | 64.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.17 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|