C12H13ClN4O — CID 108829814
(Z)-3-[(5-chloro-2-pyridinyl)amino]-2-cyano-N-propan-2-ylprop-2-enamide (PubChem CID 108829814) has the molecular formula C12H13ClN4O and a molecular weight of 264.72 g/mol. Its IUPAC name is (Z)-3-[(5-chloro-2-pyridinyl)amino]-2-cyano-N-propan-2-ylprop-2-enamide.
| Compound Name | (Z)-3-[(5-chloro-2-pyridinyl)amino]-2-cyano-N-propan-2-ylprop-2-enamide |
|---|---|
| PubChem CID | 108829814 |
| Molecular Formula | C12H13ClN4O |
| Molecular Weight | 264.72 g/mol |
| Exact Mass | 264.08 |
| IUPAC Name | (Z)-3-[(5-chloro-2-pyridinyl)amino]-2-cyano-N-propan-2-ylprop-2-enamide |
| SMILES | CC(C)NC(=O)/C(C#N)=C\Nc1ccc(Cl)cn1 |
| InChI | InChI=1S/C12H13ClN4O/c1-8(2)17-12(18)9(5-14)6-15-11-4-3-10(13)7-16-11/h3-4,6-8H,1-2H3,(H,15,16)(H,17,18)/b9-6- |
| InChIKey | ZEEIVKWUESTMML-TWGQIWQCSA-N |
| XLogP | 2.08 |
| TPSA | 77.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.72 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|