C17H17Cl3N2O4 — CID 88813798
propan-2-yl 2,3,6-trichloro-5-[(2-cyano-3-oxo-3-propan-2-yloxyprop-1-enyl)amino]benzoate (PubChem CID 88813798) has the molecular formula C17H17Cl3N2O4 and a molecular weight of 419.69 g/mol. Its IUPAC name is propan-2-yl 2,3,6-trichloro-5-[(2-cyano-3-oxo-3-propan-2-yloxyprop-1-enyl)amino]benzoate.
| Compound Name | propan-2-yl 2,3,6-trichloro-5-[(2-cyano-3-oxo-3-propan-2-yloxyprop-1-enyl)amino]benzoate |
|---|---|
| PubChem CID | 88813798 |
| Molecular Formula | C17H17Cl3N2O4 |
| Molecular Weight | 419.69 g/mol |
| Exact Mass | 418.03 |
| IUPAC Name | propan-2-yl 2,3,6-trichloro-5-[(2-cyano-3-oxo-3-propan-2-yloxyprop-1-enyl)amino]benzoate |
| SMILES | CC(C)OC(=O)C(C#N)=CNc1cc(Cl)c(Cl)c(C(=O)OC(C)C)c1Cl |
| InChI | InChI=1S/C17H17Cl3N2O4/c1-8(2)25-16(23)10(6-21)7-22-12-5-11(18)14(19)13(15(12)20)17(24)26-9(3)4/h5,7-9,22H,1-4H3 |
| InChIKey | NUDDNFBDSLKTMM-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 88.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.69 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|