C15H14Cl2N2O4 — CID 70627506
propyl 2,6-dichloro-3-[(2-cyano-3-methoxy-3-oxoprop-1-enyl)amino]benzoate (PubChem CID 70627506) has the molecular formula C15H14Cl2N2O4 and a molecular weight of 357.19 g/mol. Its IUPAC name is propyl 2,6-dichloro-3-[(2-cyano-3-methoxy-3-oxoprop-1-enyl)amino]benzoate.
| Compound Name | propyl 2,6-dichloro-3-[(2-cyano-3-methoxy-3-oxoprop-1-enyl)amino]benzoate |
|---|---|
| PubChem CID | 70627506 |
| Molecular Formula | C15H14Cl2N2O4 |
| Molecular Weight | 357.19 g/mol |
| Exact Mass | 356.03 |
| IUPAC Name | propyl 2,6-dichloro-3-[(2-cyano-3-methoxy-3-oxoprop-1-enyl)amino]benzoate |
| SMILES | CCCOC(=O)c1c(Cl)ccc(NC=C(C#N)C(=O)OC)c1Cl |
| InChI | InChI=1S/C15H14Cl2N2O4/c1-3-6-23-15(21)12-10(16)4-5-11(13(12)17)19-8-9(7-18)14(20)22-2/h4-5,8,19H,3,6H2,1-2H3 |
| InChIKey | XQBCCMPAJKPWMH-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 88.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.19 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|