C14H11Cl3N2O4 — CID 88811375
methyl 2,3,6-trichloro-5-[(2-cyano-3-ethoxy-3-oxoprop-1-enyl)amino]benzoate (PubChem CID 88811375) has the molecular formula C14H11Cl3N2O4 and a molecular weight of 377.61 g/mol. Its IUPAC name is methyl 2,3,6-trichloro-5-[(2-cyano-3-ethoxy-3-oxoprop-1-enyl)amino]benzoate.
| Compound Name | methyl 2,3,6-trichloro-5-[(2-cyano-3-ethoxy-3-oxoprop-1-enyl)amino]benzoate |
|---|---|
| PubChem CID | 88811375 |
| Molecular Formula | C14H11Cl3N2O4 |
| Molecular Weight | 377.61 g/mol |
| Exact Mass | 375.98 |
| IUPAC Name | methyl 2,3,6-trichloro-5-[(2-cyano-3-ethoxy-3-oxoprop-1-enyl)amino]benzoate |
| SMILES | CCOC(=O)C(C#N)=CNc1cc(Cl)c(Cl)c(C(=O)OC)c1Cl |
| InChI | InChI=1S/C14H11Cl3N2O4/c1-3-23-13(20)7(5-18)6-19-9-4-8(15)11(16)10(12(9)17)14(21)22-2/h4,6,19H,3H2,1-2H3 |
| InChIKey | MPTYSHCXGFWGDA-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 88.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.61 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|