C12H11Cl2N3O2 — CID 8812159
ethyl (E)-2-cyano-3-[2-(2,4-dichlorophenyl)hydrazinyl]prop-2-enoate (PubChem CID 8812159) has the molecular formula C12H11Cl2N3O2 and a molecular weight of 300.15 g/mol. Its IUPAC name is ethyl (E)-2-cyano-3-[2-(2,4-dichlorophenyl)hydrazinyl]prop-2-enoate.
| Compound Name | ethyl (E)-2-cyano-3-[2-(2,4-dichlorophenyl)hydrazinyl]prop-2-enoate |
|---|---|
| PubChem CID | 8812159 |
| Molecular Formula | C12H11Cl2N3O2 |
| Molecular Weight | 300.15 g/mol |
| Exact Mass | 299.02 |
| IUPAC Name | ethyl (E)-2-cyano-3-[2-(2,4-dichlorophenyl)hydrazinyl]prop-2-enoate |
| SMILES | CCOC(=O)/C(C#N)=C/NNc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C12H11Cl2N3O2/c1-2-19-12(18)8(6-15)7-16-17-11-4-3-9(13)5-10(11)14/h3-5,7,16-17H,2H2,1H3/b8-7+ |
| InChIKey | DDMYSUJEZZQIAB-BQYQJAHWSA-N |
| XLogP | 2.88 |
| TPSA | 74.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.15 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|