C12H10Cl2N2O2 — CID 8811229
ethyl (E)-2-cyano-3-(3,5-dichloroanilino)prop-2-enoate (PubChem CID 8811229) has the molecular formula C12H10Cl2N2O2 and a molecular weight of 285.13 g/mol. Its IUPAC name is ethyl (E)-2-cyano-3-(3,5-dichloroanilino)prop-2-enoate.
| Compound Name | ethyl (E)-2-cyano-3-(3,5-dichloroanilino)prop-2-enoate |
|---|---|
| PubChem CID | 8811229 |
| Molecular Formula | C12H10Cl2N2O2 |
| Molecular Weight | 285.13 g/mol |
| Exact Mass | 284.01 |
| IUPAC Name | ethyl (E)-2-cyano-3-(3,5-dichloroanilino)prop-2-enoate |
| SMILES | CCOC(=O)/C(C#N)=C/Nc1cc(Cl)cc(Cl)c1 |
| InChI | InChI=1S/C12H10Cl2N2O2/c1-2-18-12(17)8(6-15)7-16-11-4-9(13)3-10(14)5-11/h3-5,7,16H,2H2,1H3/b8-7+ |
| InChIKey | PITHNVNQYRJDLB-BQYQJAHWSA-N |
| XLogP | 3.38 |
| TPSA | 62.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.13 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|