C18H16ClN3O4S — CID 8811209
ethyl (E)-3-[3-[(3-chlorophenyl)sulfamoyl]anilino]-2-cyanoprop-2-enoate (PubChem CID 8811209) has the molecular formula C18H16ClN3O4S and a molecular weight of 405.86 g/mol. Its IUPAC name is ethyl (E)-3-[3-[(3-chlorophenyl)sulfamoyl]anilino]-2-cyanoprop-2-enoate.
| Compound Name | ethyl (E)-3-[3-[(3-chlorophenyl)sulfamoyl]anilino]-2-cyanoprop-2-enoate |
|---|---|
| PubChem CID | 8811209 |
| Molecular Formula | C18H16ClN3O4S |
| Molecular Weight | 405.86 g/mol |
| Exact Mass | 405.06 |
| IUPAC Name | ethyl (E)-3-[3-[(3-chlorophenyl)sulfamoyl]anilino]-2-cyanoprop-2-enoate |
| SMILES | CCOC(=O)/C(C#N)=C/Nc1cccc(S(=O)(=O)Nc2cccc(Cl)c2)c1 |
| InChI | InChI=1S/C18H16ClN3O4S/c1-2-26-18(23)13(11-20)12-21-15-6-4-8-17(10-15)27(24,25)22-16-7-3-5-14(19)9-16/h3-10,12,21-22H,2H2,1H3/b13-12+ |
| InChIKey | AEMNRMQAKGFAJP-OUKQBFOZSA-N |
| XLogP | 3.52 |
| TPSA | 108.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.86 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|