C16H19N3O3 — CID 17197549
ethyl (E)-2-cyano-3-[3-(propan-2-ylcarbamoyl)anilino]prop-2-enoate (PubChem CID 17197549) has the molecular formula C16H19N3O3 and a molecular weight of 301.35 g/mol. Its IUPAC name is ethyl (E)-2-cyano-3-[3-(propan-2-ylcarbamoyl)anilino]prop-2-enoate.
| Compound Name | ethyl (E)-2-cyano-3-[3-(propan-2-ylcarbamoyl)anilino]prop-2-enoate |
|---|---|
| PubChem CID | 17197549 |
| Molecular Formula | C16H19N3O3 |
| Molecular Weight | 301.35 g/mol |
| Exact Mass | 301.14 |
| IUPAC Name | ethyl (E)-2-cyano-3-[3-(propan-2-ylcarbamoyl)anilino]prop-2-enoate |
| SMILES | CCOC(=O)/C(C#N)=C/Nc1cccc(C(=O)NC(C)C)c1 |
| InChI | InChI=1S/C16H19N3O3/c1-4-22-16(21)13(9-17)10-18-14-7-5-6-12(8-14)15(20)19-11(2)3/h5-8,10-11,18H,4H2,1-3H3,(H,19,20)/b13-10+ |
| InChIKey | XKICEPRBESCLCD-JLHYYAGUSA-N |
| XLogP | 2.21 |
| TPSA | 91.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.35 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|