C15H18N2O4 — CID 17169949
ethyl (E)-2-cyano-3-[3-(2-methoxyethoxy)anilino]prop-2-enoate (PubChem CID 17169949) has the molecular formula C15H18N2O4 and a molecular weight of 290.32 g/mol. Its IUPAC name is ethyl (E)-2-cyano-3-[3-(2-methoxyethoxy)anilino]prop-2-enoate.
| Compound Name | ethyl (E)-2-cyano-3-[3-(2-methoxyethoxy)anilino]prop-2-enoate |
|---|---|
| PubChem CID | 17169949 |
| Molecular Formula | C15H18N2O4 |
| Molecular Weight | 290.32 g/mol |
| Exact Mass | 290.13 |
| IUPAC Name | ethyl (E)-2-cyano-3-[3-(2-methoxyethoxy)anilino]prop-2-enoate |
| SMILES | CCOC(=O)/C(C#N)=C/Nc1cccc(OCCOC)c1 |
| InChI | InChI=1S/C15H18N2O4/c1-3-20-15(18)12(10-16)11-17-13-5-4-6-14(9-13)21-8-7-19-2/h4-6,9,11,17H,3,7-8H2,1-2H3/b12-11+ |
| InChIKey | HQMILUGOARUXTQ-VAWYXSNFSA-N |
| XLogP | 2.09 |
| TPSA | 80.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.32 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|