C18H16FN3O4S — CID 47006139
ethyl (Z)-2-cyano-3-[2-[(3-fluorophenyl)sulfonylamino]anilino]prop-2-enoate (PubChem CID 47006139) has the molecular formula C18H16FN3O4S and a molecular weight of 389.41 g/mol. Its IUPAC name is ethyl (Z)-2-cyano-3-[2-[(3-fluorophenyl)sulfonylamino]anilino]prop-2-enoate.
| Compound Name | ethyl (Z)-2-cyano-3-[2-[(3-fluorophenyl)sulfonylamino]anilino]prop-2-enoate |
|---|---|
| PubChem CID | 47006139 |
| Molecular Formula | C18H16FN3O4S |
| Molecular Weight | 389.41 g/mol |
| Exact Mass | 389.08 |
| IUPAC Name | ethyl (Z)-2-cyano-3-[2-[(3-fluorophenyl)sulfonylamino]anilino]prop-2-enoate |
| SMILES | CCOC(=O)/C(C#N)=C\Nc1ccccc1NS(=O)(=O)c1cccc(F)c1 |
| InChI | InChI=1S/C18H16FN3O4S/c1-2-26-18(23)13(11-20)12-21-16-8-3-4-9-17(16)22-27(24,25)15-7-5-6-14(19)10-15/h3-10,12,21-22H,2H2,1H3/b13-12- |
| InChIKey | JSSOIBOHPXRWHH-SEYXRHQNSA-N |
| XLogP | 3.01 |
| TPSA | 108.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.41 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|