C22H21N3O4S — CID 18268064
ethyl (E)-2-cyano-3-[2-(3,4-dihydronaphthalen-2-ylsulfonylamino)anilino]prop-2-enoate (PubChem CID 18268064) has the molecular formula C22H21N3O4S and a molecular weight of 423.49 g/mol. Its IUPAC name is ethyl (E)-2-cyano-3-[2-(3,4-dihydronaphthalen-2-ylsulfonylamino)anilino]prop-2-enoate.
| Compound Name | ethyl (E)-2-cyano-3-[2-(3,4-dihydronaphthalen-2-ylsulfonylamino)anilino]prop-2-enoate |
|---|---|
| PubChem CID | 18268064 |
| Molecular Formula | C22H21N3O4S |
| Molecular Weight | 423.49 g/mol |
| Exact Mass | 423.13 |
| IUPAC Name | ethyl (E)-2-cyano-3-[2-(3,4-dihydronaphthalen-2-ylsulfonylamino)anilino]prop-2-enoate |
| SMILES | CCOC(=O)/C(C#N)=C/Nc1ccccc1NS(=O)(=O)C1=Cc2ccccc2CC1 |
| InChI | InChI=1S/C22H21N3O4S/c1-2-29-22(26)18(14-23)15-24-20-9-5-6-10-21(20)25-30(27,28)19-12-11-16-7-3-4-8-17(16)13-19/h3-10,13,15,24-25H,2,11-12H2,1H3/b18-15+ |
| InChIKey | BHKUEZFTJLAIHY-OBGWFSINSA-N |
| XLogP | 3.80 |
| TPSA | 108.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.49 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|