C20H21N3O4S — CID 7594504
ethyl (E)-2-cyano-3-[2-[(4-ethylphenyl)sulfonylamino]anilino]prop-2-enoate (PubChem CID 7594504) has the molecular formula C20H21N3O4S and a molecular weight of 399.47 g/mol. Its IUPAC name is ethyl (E)-2-cyano-3-[2-[(4-ethylphenyl)sulfonylamino]anilino]prop-2-enoate.
| Compound Name | ethyl (E)-2-cyano-3-[2-[(4-ethylphenyl)sulfonylamino]anilino]prop-2-enoate |
|---|---|
| PubChem CID | 7594504 |
| Molecular Formula | C20H21N3O4S |
| Molecular Weight | 399.47 g/mol |
| Exact Mass | 399.13 |
| IUPAC Name | ethyl (E)-2-cyano-3-[2-[(4-ethylphenyl)sulfonylamino]anilino]prop-2-enoate |
| SMILES | CCOC(=O)/C(C#N)=C/Nc1ccccc1NS(=O)(=O)c1ccc(CC)cc1 |
| InChI | InChI=1S/C20H21N3O4S/c1-3-15-9-11-17(12-10-15)28(25,26)23-19-8-6-5-7-18(19)22-14-16(13-21)20(24)27-4-2/h5-12,14,22-23H,3-4H2,1-2H3/b16-14+ |
| InChIKey | AINBTLMQAKFQGT-JQIJEIRASA-N |
| XLogP | 3.43 |
| TPSA | 108.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.47 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|