C19H20N4O5S2 — CID 16553789
ethyl (E)-3-[2-[[5-(acetamidomethyl)thiophen-2-yl]sulfonylamino]anilino]-2-cyanoprop-2-enoate (PubChem CID 16553789) has the molecular formula C19H20N4O5S2 and a molecular weight of 448.53 g/mol. Its IUPAC name is ethyl (E)-3-[2-[[5-(acetamidomethyl)thiophen-2-yl]sulfonylamino]anilino]-2-cyanoprop-2-enoate.
| Compound Name | ethyl (E)-3-[2-[[5-(acetamidomethyl)thiophen-2-yl]sulfonylamino]anilino]-2-cyanoprop-2-enoate |
|---|---|
| PubChem CID | 16553789 |
| Molecular Formula | C19H20N4O5S2 |
| Molecular Weight | 448.53 g/mol |
| Exact Mass | 448.09 |
| IUPAC Name | ethyl (E)-3-[2-[[5-(acetamidomethyl)thiophen-2-yl]sulfonylamino]anilino]-2-cyanoprop-2-enoate |
| SMILES | CCOC(=O)/C(C#N)=C/Nc1ccccc1NS(=O)(=O)c1ccc(CNC(C)=O)s1 |
| InChI | InChI=1S/C19H20N4O5S2/c1-3-28-19(25)14(10-20)11-22-16-6-4-5-7-17(16)23-30(26,27)18-9-8-15(29-18)12-21-13(2)24/h4-9,11,22-23H,3,12H2,1-2H3,(H,21,24)/b14-11+ |
| InChIKey | ZXRMAXYEIWGFPN-SDNWHVSQSA-N |
| XLogP | 2.57 |
| TPSA | 137.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.53 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|