C18H14Cl2N2O3 — CID 2798697
ethyl (E)-2-cyano-3-[2-(2,4-dichlorophenoxy)anilino]prop-2-enoate (PubChem CID 2798697) has the molecular formula C18H14Cl2N2O3 and a molecular weight of 377.23 g/mol. Its IUPAC name is ethyl (E)-2-cyano-3-[2-(2,4-dichlorophenoxy)anilino]prop-2-enoate.
| Compound Name | ethyl (E)-2-cyano-3-[2-(2,4-dichlorophenoxy)anilino]prop-2-enoate |
|---|---|
| PubChem CID | 2798697 |
| Molecular Formula | C18H14Cl2N2O3 |
| Molecular Weight | 377.23 g/mol |
| Exact Mass | 376.04 |
| IUPAC Name | ethyl (E)-2-cyano-3-[2-(2,4-dichlorophenoxy)anilino]prop-2-enoate |
| SMILES | CCOC(=O)/C(C#N)=C/Nc1ccccc1Oc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C18H14Cl2N2O3/c1-2-24-18(23)12(10-21)11-22-15-5-3-4-6-17(15)25-16-8-7-13(19)9-14(16)20/h3-9,11,22H,2H2,1H3/b12-11+ |
| InChIKey | QCPKXQGLAQKEDY-VAWYXSNFSA-N |
| XLogP | 5.17 |
| TPSA | 71.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.23 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|