C18H15Cl2N3O2 — CID 2799879
(E)-2-cyano-N-[2-(2,4-dichlorophenoxy)phenyl]-3-(dimethylamino)prop-2-enamide (PubChem CID 2799879) has the molecular formula C18H15Cl2N3O2 and a molecular weight of 376.24 g/mol. Its IUPAC name is (E)-2-cyano-N-[2-(2,4-dichlorophenoxy)phenyl]-3-(dimethylamino)prop-2-enamide.
| Compound Name | (E)-2-cyano-N-[2-(2,4-dichlorophenoxy)phenyl]-3-(dimethylamino)prop-2-enamide |
|---|---|
| PubChem CID | 2799879 |
| Molecular Formula | C18H15Cl2N3O2 |
| Molecular Weight | 376.24 g/mol |
| Exact Mass | 375.05 |
| IUPAC Name | (E)-2-cyano-N-[2-(2,4-dichlorophenoxy)phenyl]-3-(dimethylamino)prop-2-enamide |
| SMILES | CN(C)/C=C(\C#N)C(=O)Nc1ccccc1Oc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C18H15Cl2N3O2/c1-23(2)11-12(10-21)18(24)22-15-5-3-4-6-17(15)25-16-8-7-13(19)9-14(16)20/h3-9,11H,1-2H3,(H,22,24)/b12-11+ |
| InChIKey | FQXCXEQSDJMNSE-VAWYXSNFSA-N |
| XLogP | 4.69 |
| TPSA | 65.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.24 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|