C26H17Cl2N3O4 — CID 67273344
2-[3-[(E)-2-cyano-3-[2-(2,4-dichlorophenoxy)anilino]-3-oxoprop-1-enyl]indol-1-yl]acetic acid (PubChem CID 67273344) has the molecular formula C26H17Cl2N3O4 and a molecular weight of 506.35 g/mol. Its IUPAC name is 2-[3-[(E)-2-cyano-3-[2-(2,4-dichlorophenoxy)anilino]-3-oxoprop-1-enyl]indol-1-yl]acetic acid.
| Compound Name | 2-[3-[(E)-2-cyano-3-[2-(2,4-dichlorophenoxy)anilino]-3-oxoprop-1-enyl]indol-1-yl]acetic acid |
|---|---|
| PubChem CID | 67273344 |
| Molecular Formula | C26H17Cl2N3O4 |
| Molecular Weight | 506.35 g/mol |
| Exact Mass | 505.06 |
| IUPAC Name | 2-[3-[(E)-2-cyano-3-[2-(2,4-dichlorophenoxy)anilino]-3-oxoprop-1-enyl]indol-1-yl]acetic acid |
| SMILES | N#C/C(=C\c1cn(CC(=O)O)c2ccccc12)C(=O)Nc1ccccc1Oc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C26H17Cl2N3O4/c27-18-9-10-23(20(28)12-18)35-24-8-4-2-6-21(24)30-26(34)16(13-29)11-17-14-31(15-25(32)33)22-7-3-1-5-19(17)22/h1-12,14H,15H2,(H,30,34)(H,32,33)/b16-11+ |
| InChIKey | LLQCHDSZDMHLHI-LFIBNONCSA-N |
| XLogP | 6.37 |
| TPSA | 104.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.35 |
| LogP ≤ 5 | 6.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|