C27H19N3O5 — CID 11503664
2-[3-[(E)-2-cyano-3-[(2-methoxydibenzofuran-3-yl)amino]-3-oxoprop-1-enyl]indol-1-yl]acetic acid (PubChem CID 11503664) has the molecular formula C27H19N3O5 and a molecular weight of 465.47 g/mol. Its IUPAC name is 2-[3-[(E)-2-cyano-3-[(2-methoxydibenzofuran-3-yl)amino]-3-oxoprop-1-enyl]indol-1-yl]acetic acid.
| Compound Name | 2-[3-[(E)-2-cyano-3-[(2-methoxydibenzofuran-3-yl)amino]-3-oxoprop-1-enyl]indol-1-yl]acetic acid |
|---|---|
| PubChem CID | 11503664 |
| Molecular Formula | C27H19N3O5 |
| Molecular Weight | 465.47 g/mol |
| Exact Mass | 465.13 |
| IUPAC Name | 2-[3-[(E)-2-cyano-3-[(2-methoxydibenzofuran-3-yl)amino]-3-oxoprop-1-enyl]indol-1-yl]acetic acid |
| SMILES | COc1cc2c(cc1NC(=O)/C(C#N)=C/c1cn(CC(=O)O)c3ccccc13)oc1ccccc12 |
| InChI | InChI=1S/C27H19N3O5/c1-34-25-11-20-19-7-3-5-9-23(19)35-24(20)12-21(25)29-27(33)16(13-28)10-17-14-30(15-26(31)32)22-8-4-2-6-18(17)22/h2-12,14H,15H2,1H3,(H,29,33)(H,31,32)/b16-10+ |
| InChIKey | QYKMNXGYDLTOGG-MHWRWJLKSA-N |
| XLogP | 5.18 |
| TPSA | 117.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.47 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|