C49H40N6O8 — CID 69481054
2-[3-[(E)-2-cyano-3-(2-ethoxyanilino)-3-oxoprop-1-enyl]indol-1-yl]acetic acid;2-[3-[(E)-2-cyano-3-(2-methoxy-5-phenylanilino)-3-oxoprop-1-enyl]indol-1-yl]acetic acid (PubChem CID 69481054) has the molecular formula C49H40N6O8 and a molecular weight of 840.89 g/mol. Its IUPAC name is 2-[3-[(E)-2-cyano-3-(2-ethoxyanilino)-3-oxoprop-1-enyl]indol-1-yl]acetic acid;2-[3-[(E)-2-cyano-3-(2-methoxy-5-phenylanilino)-3-oxoprop-1-enyl]indol-1-yl]acetic acid.
| Compound Name | 2-[3-[(E)-2-cyano-3-(2-ethoxyanilino)-3-oxoprop-1-enyl]indol-1-yl]acetic acid;2-[3-[(E)-2-cyano-3-(2-methoxy-5-phenylanilino)-3-oxoprop-1-enyl]indol-1-yl]acetic acid |
|---|---|
| PubChem CID | 69481054 |
| Molecular Formula | C49H40N6O8 |
| Molecular Weight | 840.89 g/mol |
| Exact Mass | 840.29 |
| IUPAC Name | 2-[3-[(E)-2-cyano-3-(2-ethoxyanilino)-3-oxoprop-1-enyl]indol-1-yl]acetic acid;2-[3-[(E)-2-cyano-3-(2-methoxy-5-phenylanilino)-3-oxoprop-1-enyl]indol-1-yl]acetic acid |
| SMILES | CCOc1ccccc1NC(=O)/C(C#N)=C/c1cn(CC(=O)O)c2ccccc12.COc1ccc(-c2ccccc2)cc1NC(=O)/C(C#N)=C/c1cn(CC(=O)O)c2ccccc12 |
| InChI | InChI=1S/C27H21N3O4.C22H19N3O4/c1-34-25-12-11-19(18-7-3-2-4-8-18)14-23(25)29-27(33)20(15-28)13-21-16-30(17-26(31)32)24-10-6-5-9-22(21)24;1-2-29-20-10-6-4-8-18(20)24-22(28)15(12-23)11-16-13-25(14-21(26)27)19-9-5-3-7-17(16)19/h2-14,16H,17H2,1H3,(H,29,33)(H,31,32);3-11,13H,2,14H2,1H3,(H,24,28)(H,26,27)/b20-13+;15-11+ |
| InChIKey | BTGKJUMYBUXTHL-XAVVRKKZSA-N |
| XLogP | 8.62 |
| TPSA | 208.70 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 63 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 840.89 |
| LogP ≤ 5 | 8.62 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|