C26H18Cl3N3O2 — CID 17268641
(E)-N-(5-chloro-2-methoxyphenyl)-2-cyano-3-[1-[(2,4-dichlorophenyl)methyl]indol-3-yl]prop-2-enamide (PubChem CID 17268641) has the molecular formula C26H18Cl3N3O2 and a molecular weight of 510.81 g/mol. Its IUPAC name is (E)-N-(5-chloro-2-methoxyphenyl)-2-cyano-3-[1-[(2,4-dichlorophenyl)methyl]indol-3-yl]prop-2-enamide.
| Compound Name | (E)-N-(5-chloro-2-methoxyphenyl)-2-cyano-3-[1-[(2,4-dichlorophenyl)methyl]indol-3-yl]prop-2-enamide |
|---|---|
| PubChem CID | 17268641 |
| Molecular Formula | C26H18Cl3N3O2 |
| Molecular Weight | 510.81 g/mol |
| Exact Mass | 509.05 |
| IUPAC Name | (E)-N-(5-chloro-2-methoxyphenyl)-2-cyano-3-[1-[(2,4-dichlorophenyl)methyl]indol-3-yl]prop-2-enamide |
| SMILES | COc1ccc(Cl)cc1NC(=O)/C(C#N)=C/c1cn(Cc2ccc(Cl)cc2Cl)c2ccccc12 |
| InChI | InChI=1S/C26H18Cl3N3O2/c1-34-25-9-8-20(28)12-23(25)31-26(33)17(13-30)10-18-15-32(24-5-3-2-4-21(18)24)14-16-6-7-19(27)11-22(16)29/h2-12,15H,14H2,1H3,(H,31,33)/b17-10+ |
| InChIKey | CUZBRFFAJQYHIU-LICLKQGHSA-N |
| XLogP | 7.20 |
| TPSA | 67.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.81 |
| LogP ≤ 5 | 7.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|