C24H15Cl3N2 — CID 4038734
2-(2-chlorophenyl)-3-[1-[(2,4-dichlorophenyl)methyl]indol-3-yl]prop-2-enenitrile (PubChem CID 4038734) has the molecular formula C24H15Cl3N2 and a molecular weight of 437.76 g/mol. Its IUPAC name is 2-(2-chlorophenyl)-3-[1-[(2,4-dichlorophenyl)methyl]indol-3-yl]prop-2-enenitrile.
| Compound Name | 2-(2-chlorophenyl)-3-[1-[(2,4-dichlorophenyl)methyl]indol-3-yl]prop-2-enenitrile |
|---|---|
| PubChem CID | 4038734 |
| Molecular Formula | C24H15Cl3N2 |
| Molecular Weight | 437.76 g/mol |
| Exact Mass | 436.03 |
| IUPAC Name | 2-(2-chlorophenyl)-3-[1-[(2,4-dichlorophenyl)methyl]indol-3-yl]prop-2-enenitrile |
| SMILES | N#CC(=Cc1cn(Cc2ccc(Cl)cc2Cl)c2ccccc12)c1ccccc1Cl |
| InChI | InChI=1S/C24H15Cl3N2/c25-19-10-9-16(23(27)12-19)14-29-15-18(21-6-2-4-8-24(21)29)11-17(13-28)20-5-1-3-7-22(20)26/h1-12,15H,14H2 |
| InChIKey | GZWWRFWUJAMMOT-UHFFFAOYSA-N |
| XLogP | 7.71 |
| TPSA | 28.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.76 |
| LogP ≤ 5 | 7.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|