C25H16Cl2N4 — CID 2849770
2-(1H-benzimidazol-2-yl)-3-[1-[(2,4-dichlorophenyl)methyl]indol-3-yl]prop-2-enenitrile (PubChem CID 2849770) has the molecular formula C25H16Cl2N4 and a molecular weight of 443.34 g/mol. Its IUPAC name is 2-(1H-benzimidazol-2-yl)-3-[1-[(2,4-dichlorophenyl)methyl]indol-3-yl]prop-2-enenitrile.
| Compound Name | 2-(1H-benzimidazol-2-yl)-3-[1-[(2,4-dichlorophenyl)methyl]indol-3-yl]prop-2-enenitrile |
|---|---|
| PubChem CID | 2849770 |
| Molecular Formula | C25H16Cl2N4 |
| Molecular Weight | 443.34 g/mol |
| Exact Mass | 442.08 |
| IUPAC Name | 2-(1H-benzimidazol-2-yl)-3-[1-[(2,4-dichlorophenyl)methyl]indol-3-yl]prop-2-enenitrile |
| SMILES | N#CC(=Cc1cn(Cc2ccc(Cl)cc2Cl)c2ccccc12)c1nc2ccccc2[nH]1 |
| InChI | InChI=1S/C25H16Cl2N4/c26-19-10-9-16(21(27)12-19)14-31-15-18(20-5-1-4-8-24(20)31)11-17(13-28)25-29-22-6-2-3-7-23(22)30-25/h1-12,15H,14H2,(H,29,30) |
| InChIKey | YOBXATDJVYQWQL-UHFFFAOYSA-N |
| XLogP | 6.94 |
| TPSA | 57.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.34 |
| LogP ≤ 5 | 6.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|