C28H21Cl2N5O2 — CID 171155146
acetic acid;2-(1H-benzimidazol-2-yl)-3-[1-[(2,4-dichlorophenyl)methyl]-3-phenylpyrazol-4-yl]prop-2-enenitrile (PubChem CID 171155146) has the molecular formula C28H21Cl2N5O2 and a molecular weight of 530.42 g/mol. Its IUPAC name is acetic acid;2-(1H-benzimidazol-2-yl)-3-[1-[(2,4-dichlorophenyl)methyl]-3-phenylpyrazol-4-yl]prop-2-enenitrile.
| Compound Name | acetic acid;2-(1H-benzimidazol-2-yl)-3-[1-[(2,4-dichlorophenyl)methyl]-3-phenylpyrazol-4-yl]prop-2-enenitrile |
|---|---|
| PubChem CID | 171155146 |
| Molecular Formula | C28H21Cl2N5O2 |
| Molecular Weight | 530.42 g/mol |
| Exact Mass | 529.11 |
| IUPAC Name | acetic acid;2-(1H-benzimidazol-2-yl)-3-[1-[(2,4-dichlorophenyl)methyl]-3-phenylpyrazol-4-yl]prop-2-enenitrile |
| SMILES | CC(=O)O.N#CC(=Cc1cn(Cc2ccc(Cl)cc2Cl)nc1-c1ccccc1)c1nc2ccccc2[nH]1 |
| InChI | InChI=1S/C26H17Cl2N5.C2H4O2/c27-21-11-10-18(22(28)13-21)15-33-16-20(25(32-33)17-6-2-1-3-7-17)12-19(14-29)26-30-23-8-4-5-9-24(23)31-26;1-2(3)4/h1-13,16H,15H2,(H,30,31);1H3,(H,3,4) |
| InChIKey | NMEKNCDKFOMEHM-UHFFFAOYSA-N |
| XLogP | 6.94 |
| TPSA | 107.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.42 |
| LogP ≤ 5 | 6.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|