C27H24Cl2N4O — CID 2852534
2-(1H-benzimidazol-2-yl)-3-[2-[(2,4-dichlorophenyl)methoxy]-4-(diethylamino)phenyl]prop-2-enenitrile (PubChem CID 2852534) has the molecular formula C27H24Cl2N4O and a molecular weight of 491.42 g/mol. Its IUPAC name is 2-(1H-benzimidazol-2-yl)-3-[2-[(2,4-dichlorophenyl)methoxy]-4-(diethylamino)phenyl]prop-2-enenitrile.
| Compound Name | 2-(1H-benzimidazol-2-yl)-3-[2-[(2,4-dichlorophenyl)methoxy]-4-(diethylamino)phenyl]prop-2-enenitrile |
|---|---|
| PubChem CID | 2852534 |
| Molecular Formula | C27H24Cl2N4O |
| Molecular Weight | 491.42 g/mol |
| Exact Mass | 490.13 |
| IUPAC Name | 2-(1H-benzimidazol-2-yl)-3-[2-[(2,4-dichlorophenyl)methoxy]-4-(diethylamino)phenyl]prop-2-enenitrile |
| SMILES | CCN(CC)c1ccc(C=C(C#N)c2nc3ccccc3[nH]2)c(OCc2ccc(Cl)cc2Cl)c1 |
| InChI | InChI=1S/C27H24Cl2N4O/c1-3-33(4-2)22-12-10-18(26(15-22)34-17-19-9-11-21(28)14-23(19)29)13-20(16-30)27-31-24-7-5-6-8-25(24)32-27/h5-15H,3-4,17H2,1-2H3,(H,31,32) |
| InChIKey | JPUQPJJJWXTEGN-UHFFFAOYSA-N |
| XLogP | 7.36 |
| TPSA | 64.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.42 |
| LogP ≤ 5 | 7.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|