C24H28N4O — CID 18527077
(Z)-2-(1H-benzimidazol-2-yl)-3-[2-butoxy-4-(diethylamino)phenyl]prop-2-enenitrile (PubChem CID 18527077) has the molecular formula C24H28N4O and a molecular weight of 388.52 g/mol. Its IUPAC name is (Z)-2-(1H-benzimidazol-2-yl)-3-[2-butoxy-4-(diethylamino)phenyl]prop-2-enenitrile.
| Compound Name | (Z)-2-(1H-benzimidazol-2-yl)-3-[2-butoxy-4-(diethylamino)phenyl]prop-2-enenitrile |
|---|---|
| PubChem CID | 18527077 |
| Molecular Formula | C24H28N4O |
| Molecular Weight | 388.52 g/mol |
| Exact Mass | 388.23 |
| IUPAC Name | (Z)-2-(1H-benzimidazol-2-yl)-3-[2-butoxy-4-(diethylamino)phenyl]prop-2-enenitrile |
| SMILES | CCCCOc1cc(N(CC)CC)ccc1/C=C(/C#N)c1nc2ccccc2[nH]1 |
| InChI | InChI=1S/C24H28N4O/c1-4-7-14-29-23-16-20(28(5-2)6-3)13-12-18(23)15-19(17-25)24-26-21-10-8-9-11-22(21)27-24/h8-13,15-16H,4-7,14H2,1-3H3,(H,26,27)/b19-15- |
| InChIKey | PVVUTKIJROXBQZ-CYVLTUHYSA-N |
| XLogP | 5.65 |
| TPSA | 64.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.52 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|