C21H17BrN4O2 — CID 71950514
4-[4-[2-(1H-benzimidazol-2-yl)-2-cyanoethenyl]-2-bromo-5-methoxyphenoxy]butanenitrile (PubChem CID 71950514) has the molecular formula C21H17BrN4O2 and a molecular weight of 437.30 g/mol. Its IUPAC name is 4-[4-[2-(1H-benzimidazol-2-yl)-2-cyanoethenyl]-2-bromo-5-methoxyphenoxy]butanenitrile.
| Compound Name | 4-[4-[2-(1H-benzimidazol-2-yl)-2-cyanoethenyl]-2-bromo-5-methoxyphenoxy]butanenitrile |
|---|---|
| PubChem CID | 71950514 |
| Molecular Formula | C21H17BrN4O2 |
| Molecular Weight | 437.30 g/mol |
| Exact Mass | 436.05 |
| IUPAC Name | 4-[4-[2-(1H-benzimidazol-2-yl)-2-cyanoethenyl]-2-bromo-5-methoxyphenoxy]butanenitrile |
| SMILES | COc1cc(OCCCC#N)c(Br)cc1C=C(C#N)c1nc2ccccc2[nH]1 |
| InChI | InChI=1S/C21H17BrN4O2/c1-27-19-12-20(28-9-5-4-8-23)16(22)11-14(19)10-15(13-24)21-25-17-6-2-3-7-18(17)26-21/h2-3,6-7,10-12H,4-5,9H2,1H3,(H,25,26) |
| InChIKey | RSSLPTPMIZYYEI-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 94.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.30 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|