C19H15Br2N3O — CID 18527079
(Z)-2-(1H-benzimidazol-2-yl)-3-(3,5-dibromo-2-propan-2-yloxyphenyl)prop-2-enenitrile (PubChem CID 18527079) has the molecular formula C19H15Br2N3O and a molecular weight of 461.16 g/mol. Its IUPAC name is (Z)-2-(1H-benzimidazol-2-yl)-3-(3,5-dibromo-2-propan-2-yloxyphenyl)prop-2-enenitrile.
| Compound Name | (Z)-2-(1H-benzimidazol-2-yl)-3-(3,5-dibromo-2-propan-2-yloxyphenyl)prop-2-enenitrile |
|---|---|
| PubChem CID | 18527079 |
| Molecular Formula | C19H15Br2N3O |
| Molecular Weight | 461.16 g/mol |
| Exact Mass | 458.96 |
| IUPAC Name | (Z)-2-(1H-benzimidazol-2-yl)-3-(3,5-dibromo-2-propan-2-yloxyphenyl)prop-2-enenitrile |
| SMILES | CC(C)Oc1c(Br)cc(Br)cc1/C=C(/C#N)c1nc2ccccc2[nH]1 |
| InChI | InChI=1S/C19H15Br2N3O/c1-11(2)25-18-12(8-14(20)9-15(18)21)7-13(10-22)19-23-16-5-3-4-6-17(16)24-19/h3-9,11H,1-2H3,(H,23,24)/b13-7- |
| InChIKey | BGJUDKNXHKTMOA-QPEQYQDCSA-N |
| XLogP | 5.94 |
| TPSA | 61.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.16 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|