C17H11BrN4O4 — CID 135607303
(E)-2-(1H-benzimidazol-2-yl)-3-(5-bromo-4-hydroxy-3-methoxy-2-nitrophenyl)prop-2-enenitrile (PubChem CID 135607303) has the molecular formula C17H11BrN4O4 and a molecular weight of 415.20 g/mol. Its IUPAC name is (E)-2-(1H-benzimidazol-2-yl)-3-(5-bromo-4-hydroxy-3-methoxy-2-nitrophenyl)prop-2-enenitrile.
| Compound Name | (E)-2-(1H-benzimidazol-2-yl)-3-(5-bromo-4-hydroxy-3-methoxy-2-nitrophenyl)prop-2-enenitrile |
|---|---|
| PubChem CID | 135607303 |
| Molecular Formula | C17H11BrN4O4 |
| Molecular Weight | 415.20 g/mol |
| Exact Mass | 414.00 |
| IUPAC Name | (E)-2-(1H-benzimidazol-2-yl)-3-(5-bromo-4-hydroxy-3-methoxy-2-nitrophenyl)prop-2-enenitrile |
| SMILES | COc1c(O)c(Br)cc(/C=C(\C#N)c2nc3ccccc3[nH]2)c1[N+](=O)[O-] |
| InChI | InChI=1S/C17H11BrN4O4/c1-26-16-14(22(24)25)9(7-11(18)15(16)23)6-10(8-19)17-20-12-4-2-3-5-13(12)21-17/h2-7,23H,1H3,(H,20,21)/b10-6+ |
| InChIKey | MAJXRBCMLVLZAR-UXBLZVDNSA-N |
| XLogP | 4.01 |
| TPSA | 125.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.20 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|