C27H20Cl2N4 — CID 3501404
3-[1-[(2,6-dichlorophenyl)methyl]indol-3-yl]-2-(5,6-dimethyl-1H-benzimidazol-2-yl)prop-2-enenitrile (PubChem CID 3501404) has the molecular formula C27H20Cl2N4 and a molecular weight of 471.39 g/mol. Its IUPAC name is 3-[1-[(2,6-dichlorophenyl)methyl]indol-3-yl]-2-(5,6-dimethyl-1H-benzimidazol-2-yl)prop-2-enenitrile.
| Compound Name | 3-[1-[(2,6-dichlorophenyl)methyl]indol-3-yl]-2-(5,6-dimethyl-1H-benzimidazol-2-yl)prop-2-enenitrile |
|---|---|
| PubChem CID | 3501404 |
| Molecular Formula | C27H20Cl2N4 |
| Molecular Weight | 471.39 g/mol |
| Exact Mass | 470.11 |
| IUPAC Name | 3-[1-[(2,6-dichlorophenyl)methyl]indol-3-yl]-2-(5,6-dimethyl-1H-benzimidazol-2-yl)prop-2-enenitrile |
| SMILES | Cc1cc2nc(C(C#N)=Cc3cn(Cc4c(Cl)cccc4Cl)c4ccccc34)[nH]c2cc1C |
| InChI | InChI=1S/C27H20Cl2N4/c1-16-10-24-25(11-17(16)2)32-27(31-24)18(13-30)12-19-14-33(26-9-4-3-6-20(19)26)15-21-22(28)7-5-8-23(21)29/h3-12,14H,15H2,1-2H3,(H,31,32) |
| InChIKey | JWPZJAPGEQAWCO-UHFFFAOYSA-N |
| XLogP | 7.55 |
| TPSA | 57.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.39 |
| LogP ≤ 5 | 7.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|