C26H19N5O2 — CID 4206251
2-(6-methyl-1H-benzimidazol-2-yl)-3-[1-[(4-nitrophenyl)methyl]indol-3-yl]prop-2-enenitrile (PubChem CID 4206251) has the molecular formula C26H19N5O2 and a molecular weight of 433.47 g/mol. Its IUPAC name is 2-(6-methyl-1H-benzimidazol-2-yl)-3-[1-[(4-nitrophenyl)methyl]indol-3-yl]prop-2-enenitrile.
| Compound Name | 2-(6-methyl-1H-benzimidazol-2-yl)-3-[1-[(4-nitrophenyl)methyl]indol-3-yl]prop-2-enenitrile |
|---|---|
| PubChem CID | 4206251 |
| Molecular Formula | C26H19N5O2 |
| Molecular Weight | 433.47 g/mol |
| Exact Mass | 433.15 |
| IUPAC Name | 2-(6-methyl-1H-benzimidazol-2-yl)-3-[1-[(4-nitrophenyl)methyl]indol-3-yl]prop-2-enenitrile |
| SMILES | Cc1ccc2nc(C(C#N)=Cc3cn(Cc4ccc([N+](=O)[O-])cc4)c4ccccc34)[nH]c2c1 |
| InChI | InChI=1S/C26H19N5O2/c1-17-6-11-23-24(12-17)29-26(28-23)19(14-27)13-20-16-30(25-5-3-2-4-22(20)25)15-18-7-9-21(10-8-18)31(32)33/h2-13,16H,15H2,1H3,(H,28,29) |
| InChIKey | JJJGOFJXADAPNM-UHFFFAOYSA-N |
| XLogP | 5.85 |
| TPSA | 100.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.47 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|