C24H16Br2N4O3 — CID 126376857
(Z)-3-[3,5-dibromo-4-[(4-nitrophenyl)methoxy]phenyl]-2-(6-methyl-1H-benzimidazol-2-yl)prop-2-enenitrile (PubChem CID 126376857) has the molecular formula C24H16Br2N4O3 and a molecular weight of 568.23 g/mol. Its IUPAC name is (Z)-3-[3,5-dibromo-4-[(4-nitrophenyl)methoxy]phenyl]-2-(6-methyl-1H-benzimidazol-2-yl)prop-2-enenitrile.
| Compound Name | (Z)-3-[3,5-dibromo-4-[(4-nitrophenyl)methoxy]phenyl]-2-(6-methyl-1H-benzimidazol-2-yl)prop-2-enenitrile |
|---|---|
| PubChem CID | 126376857 |
| Molecular Formula | C24H16Br2N4O3 |
| Molecular Weight | 568.23 g/mol |
| Exact Mass | 565.96 |
| IUPAC Name | (Z)-3-[3,5-dibromo-4-[(4-nitrophenyl)methoxy]phenyl]-2-(6-methyl-1H-benzimidazol-2-yl)prop-2-enenitrile |
| SMILES | Cc1ccc2nc(/C(C#N)=C\c3cc(Br)c(OCc4ccc([N+](=O)[O-])cc4)c(Br)c3)[nH]c2c1 |
| InChI | InChI=1S/C24H16Br2N4O3/c1-14-2-7-21-22(8-14)29-24(28-21)17(12-27)9-16-10-19(25)23(20(26)11-16)33-13-15-3-5-18(6-4-15)30(31)32/h2-11H,13H2,1H3,(H,28,29)/b17-9- |
| InChIKey | CZDUOQZUXZSPNW-MFOYZWKCSA-N |
| XLogP | 6.95 |
| TPSA | 104.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.23 |
| LogP ≤ 5 | 6.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|