C27H20N4O2 — CID 6072142
methyl 3-[[3-[(E)-2-(1H-benzimidazol-2-yl)-2-cyanoethenyl]indol-1-yl]methyl]benzoate (PubChem CID 6072142) has the molecular formula C27H20N4O2 and a molecular weight of 432.48 g/mol. Its IUPAC name is methyl 3-[[3-[(E)-2-(1H-benzimidazol-2-yl)-2-cyanoethenyl]indol-1-yl]methyl]benzoate.
| Compound Name | methyl 3-[[3-[(E)-2-(1H-benzimidazol-2-yl)-2-cyanoethenyl]indol-1-yl]methyl]benzoate |
|---|---|
| PubChem CID | 6072142 |
| Molecular Formula | C27H20N4O2 |
| Molecular Weight | 432.48 g/mol |
| Exact Mass | 432.16 |
| IUPAC Name | methyl 3-[[3-[(E)-2-(1H-benzimidazol-2-yl)-2-cyanoethenyl]indol-1-yl]methyl]benzoate |
| SMILES | COC(=O)c1cccc(Cn2cc(/C=C(\C#N)c3nc4ccccc4[nH]3)c3ccccc32)c1 |
| InChI | InChI=1S/C27H20N4O2/c1-33-27(32)19-8-6-7-18(13-19)16-31-17-21(22-9-2-5-12-25(22)31)14-20(15-28)26-29-23-10-3-4-11-24(23)30-26/h2-14,17H,16H2,1H3,(H,29,30)/b20-14+ |
| InChIKey | XKQAZTDDMTYGBL-XSFVSMFZSA-N |
| XLogP | 5.42 |
| TPSA | 83.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.48 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|