C22H18N4O2 — CID 21231306
ethyl 2-[3-[(Z)-2-(1H-benzimidazol-2-yl)-2-cyanoethenyl]indol-1-yl]acetate (PubChem CID 21231306) has the molecular formula C22H18N4O2 and a molecular weight of 370.41 g/mol. Its IUPAC name is ethyl 2-[3-[(Z)-2-(1H-benzimidazol-2-yl)-2-cyanoethenyl]indol-1-yl]acetate.
| Compound Name | ethyl 2-[3-[(Z)-2-(1H-benzimidazol-2-yl)-2-cyanoethenyl]indol-1-yl]acetate |
|---|---|
| PubChem CID | 21231306 |
| Molecular Formula | C22H18N4O2 |
| Molecular Weight | 370.41 g/mol |
| Exact Mass | 370.14 |
| IUPAC Name | ethyl 2-[3-[(Z)-2-(1H-benzimidazol-2-yl)-2-cyanoethenyl]indol-1-yl]acetate |
| SMILES | CCOC(=O)Cn1cc(/C=C(/C#N)c2nc3ccccc3[nH]2)c2ccccc21 |
| InChI | InChI=1S/C22H18N4O2/c1-2-28-21(27)14-26-13-16(17-7-3-6-10-20(17)26)11-15(12-23)22-24-18-8-4-5-9-19(18)25-22/h3-11,13H,2,14H2,1H3,(H,24,25)/b15-11- |
| InChIKey | VACRYZCHNSVAFJ-PTNGSMBKSA-N |
| XLogP | 4.14 |
| TPSA | 83.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.41 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|