C12H11N3O — CID 66489792
(E)-2-(1H-benzimidazol-2-yl)-3-ethoxyprop-2-enenitrile (PubChem CID 66489792) has the molecular formula C12H11N3O and a molecular weight of 213.24 g/mol. Its IUPAC name is (E)-2-(1H-benzimidazol-2-yl)-3-ethoxyprop-2-enenitrile.
| Compound Name | (E)-2-(1H-benzimidazol-2-yl)-3-ethoxyprop-2-enenitrile |
|---|---|
| PubChem CID | 66489792 |
| Molecular Formula | C12H11N3O |
| Molecular Weight | 213.24 g/mol |
| Exact Mass | 213.09 |
| IUPAC Name | (E)-2-(1H-benzimidazol-2-yl)-3-ethoxyprop-2-enenitrile |
| SMILES | CCO/C=C(\C#N)c1nc2ccccc2[nH]1 |
| InChI | InChI=1S/C12H11N3O/c1-2-16-8-9(7-13)12-14-10-5-3-4-6-11(10)15-12/h3-6,8H,2H2,1H3,(H,14,15)/b9-8+ |
| InChIKey | SFLLTPDABSFRHW-CMDGGOBGSA-N |
| XLogP | 2.46 |
| TPSA | 61.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.24 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|