C10H7N3O — CID 903305
2-(1H-benzimidazol-2-yl)-3-hydroxyprop-2-enenitrile (PubChem CID 903305) has the molecular formula C10H7N3O and a molecular weight of 185.19 g/mol. Its IUPAC name is 2-(1H-benzimidazol-2-yl)-3-hydroxyprop-2-enenitrile.
| Compound Name | 2-(1H-benzimidazol-2-yl)-3-hydroxyprop-2-enenitrile |
|---|---|
| PubChem CID | 903305 |
| Molecular Formula | C10H7N3O |
| Molecular Weight | 185.19 g/mol |
| Exact Mass | 185.06 |
| IUPAC Name | 2-(1H-benzimidazol-2-yl)-3-hydroxyprop-2-enenitrile |
| SMILES | N#CC(=CO)c1nc2ccccc2[nH]1 |
| InChI | InChI=1S/C10H7N3O/c11-5-7(6-14)10-12-8-3-1-2-4-9(8)13-10/h1-4,6,14H,(H,12,13) |
| InChIKey | PGUFXFMJESTTAE-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 72.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 185.19 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|