C14H8BrN3S — CID 25111454
(E)-2-(1H-benzimidazol-2-yl)-3-(5-bromothiophen-3-yl)prop-2-enenitrile (PubChem CID 25111454) has the molecular formula C14H8BrN3S and a molecular weight of 330.21 g/mol. Its IUPAC name is (E)-2-(1H-benzimidazol-2-yl)-3-(5-bromothiophen-3-yl)prop-2-enenitrile.
| Compound Name | (E)-2-(1H-benzimidazol-2-yl)-3-(5-bromothiophen-3-yl)prop-2-enenitrile |
|---|---|
| PubChem CID | 25111454 |
| Molecular Formula | C14H8BrN3S |
| Molecular Weight | 330.21 g/mol |
| Exact Mass | 328.96 |
| IUPAC Name | (E)-2-(1H-benzimidazol-2-yl)-3-(5-bromothiophen-3-yl)prop-2-enenitrile |
| SMILES | N#C/C(=C\c1csc(Br)c1)c1nc2ccccc2[nH]1 |
| InChI | InChI=1S/C14H8BrN3S/c15-13-6-9(8-19-13)5-10(7-16)14-17-11-3-1-2-4-12(11)18-14/h1-6,8H,(H,17,18)/b10-5+ |
| InChIKey | WGYDWSQCRFHYGF-BJMVGYQFSA-N |
| XLogP | 4.45 |
| TPSA | 52.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.21 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|