C16H21NO2 — CID 145169068
ethane;ethyl 2-(3-ethenylindol-1-yl)acetate (PubChem CID 145169068) has the molecular formula C16H21NO2 and a molecular weight of 259.35 g/mol. Its IUPAC name is ethane;ethyl 2-(3-ethenylindol-1-yl)acetate.
| Compound Name | ethane;ethyl 2-(3-ethenylindol-1-yl)acetate |
|---|---|
| PubChem CID | 145169068 |
| Molecular Formula | C16H21NO2 |
| Molecular Weight | 259.35 g/mol |
| Exact Mass | 259.16 |
| IUPAC Name | ethane;ethyl 2-(3-ethenylindol-1-yl)acetate |
| SMILES | C=Cc1cn(CC(=O)OCC)c2ccccc12.CC |
| InChI | InChI=1S/C14H15NO2.C2H6/c1-3-11-9-15(10-14(16)17-4-2)13-8-6-5-7-12(11)13;1-2/h3,5-9H,1,4,10H2,2H3;1-2H3 |
| InChIKey | FUBOXZMGLYNLGZ-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 31.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.35 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |